C20H20N2O — CID 113211761
N-methyl-1-(2-methyl-1H-indol-3-yl)-N-phenylcyclopropane-1-carboxamide (PubChem CID 113211761) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-1H-indol-3-yl)-N-phenylcyclopropane-1-carboxamide.
| Compound Name | N-methyl-1-(2-methyl-1H-indol-3-yl)-N-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113211761 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-methyl-1-(2-methyl-1H-indol-3-yl)-N-phenylcyclopropane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C1(C(=O)N(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N2O/c1-14-18(16-10-6-7-11-17(16)21-14)20(12-13-20)19(23)22(2)15-8-4-3-5-9-15/h3-11,21H,12-13H2,1-2H3 |
| InChIKey | HSMHRDVOVRZAOY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |