C14H13NO4 — CID 116857995
1-(2-methyl-1H-indol-3-yl)cyclopropane-1,2-dicarboxylic acid (PubChem CID 116857995) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)cyclopropane-1,2-dicarboxylic acid.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)cyclopropane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 116857995 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)cyclopropane-1,2-dicarboxylic acid |
| SMILES | Cc1[nH]c2ccccc2c1C1(C(=O)O)CC1C(=O)O |
| InChI | InChI=1S/C14H13NO4/c1-7-11(8-4-2-3-5-10(8)15-7)14(13(18)19)6-9(14)12(16)17/h2-5,9,15H,6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | FHQLLDYULGWSRZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |