C14H15NO3 — CID 116930115
3-[(2-methyl-1H-indol-3-yl)methyl]oxetane-3-carboxylic acid (PubChem CID 116930115) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-[(2-methyl-1H-indol-3-yl)methyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[(2-methyl-1H-indol-3-yl)methyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 116930115 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-[(2-methyl-1H-indol-3-yl)methyl]oxetane-3-carboxylic acid |
| SMILES | Cc1[nH]c2ccccc2c1CC1(C(=O)O)COC1 |
| InChI | InChI=1S/C14H15NO3/c1-9-11(6-14(13(16)17)7-18-8-14)10-4-2-3-5-12(10)15-9/h2-5,15H,6-8H2,1H3,(H,16,17) |
| InChIKey | VSRVBZHDWHMFLR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|