C17H20N2O4 — CID 120543132
4-[[(2-methyl-1H-indole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 120543132) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[[(2-methyl-1H-indole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(2-methyl-1H-indole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120543132 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[[(2-methyl-1H-indole-3-carbonyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)NCC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C17H20N2O4/c1-11-14(12-4-2-3-5-13(12)19-11)15(20)18-10-17(16(21)22)6-8-23-9-7-17/h2-5,19H,6-10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | KBHWLGFYBWJZJU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |