C17H18N2O4 — CID 120543387
4-[(isoquinoline-4-carbonylamino)methyl]oxane-4-carboxylic acid (PubChem CID 120543387) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[(isoquinoline-4-carbonylamino)methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[(isoquinoline-4-carbonylamino)methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120543387 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[(isoquinoline-4-carbonylamino)methyl]oxane-4-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCOCC1)c1cncc2ccccc12 |
| InChI | InChI=1S/C17H18N2O4/c20-15(14-10-18-9-12-3-1-2-4-13(12)14)19-11-17(16(21)22)5-7-23-8-6-17/h1-4,9-10H,5-8,11H2,(H,19,20)(H,21,22) |
| InChIKey | UTBFBFLQOAVZRH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |