C19H24N2O3 — CID 120544579
1-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544579) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544579 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)NCC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C19H24N2O3/c1-13-15(14-7-3-4-8-16(14)21-13)11-17(22)20-12-19(18(23)24)9-5-2-6-10-19/h3-4,7-8,21H,2,5-6,9-12H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | PPCRGQHXMUYNMO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|