C10H10O4 — CID 11321480
(3aR,5aR,8aS,8bS)-1,3a,5a,8,8a,8b-hexahydrofuro[3,2-e][1]benzofuran-2,7-dione (PubChem CID 11321480) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (3aR,5aR,8aS,8bS)-1,3a,5a,8,8a,8b-hexahydrofuro[3,2-e][1]benzofuran-2,7-dione.
| Compound Name | (3aR,5aR,8aS,8bS)-1,3a,5a,8,8a,8b-hexahydrofuro[3,2-e][1]benzofuran-2,7-dione |
|---|---|
| PubChem CID | 11321480 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3aR,5aR,8aS,8bS)-1,3a,5a,8,8a,8b-hexahydrofuro[3,2-e][1]benzofuran-2,7-dione |
| SMILES | O=C1C[C@H]2[C@@H]3CC(=O)O[C@@H]3C=C[C@H]2O1 |
| InChI | InChI=1S/C10H10O4/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-2,5-8H,3-4H2/t5-,6-,7+,8+/m0/s1 |
| InChIKey | MQBOADYKXJDCRX-RULNZFCNSA-N |
| XLogP | 0.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|