C21H22N2O3 — CID 113217951
(3Z)-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methylidene]-1-methylindol-2-one (PubChem CID 113217951) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (3Z)-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 113217951 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (3Z)-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methylidene]-1-methylindol-2-one |
| SMILES | COc1cc2c(cc1OC)CN(/C=C1\C(=O)N(C)c3ccccc31)CC2 |
| InChI | InChI=1S/C21H22N2O3/c1-22-18-7-5-4-6-16(18)17(21(22)24)13-23-9-8-14-10-19(25-2)20(26-3)11-15(14)12-23/h4-7,10-11,13H,8-9,12H2,1-3H3/b17-13- |
| InChIKey | FCDYXWFNUFKIPM-LGMDPLHJSA-N |
| XLogP | 3.08 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|