C19H18N2O — CID 113217969
(3E)-3-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-1-methylindol-2-one (PubChem CID 113217969) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is (3E)-3-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-1-methylindol-2-one.
| Compound Name | (3E)-3-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-1-methylindol-2-one |
|---|---|
| PubChem CID | 113217969 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (3E)-3-(3,4-dihydro-2H-quinolin-1-ylmethylidene)-1-methylindol-2-one |
| SMILES | CN1C(=O)/C(=C/N2CCCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C19H18N2O/c1-20-18-11-5-3-9-15(18)16(19(20)22)13-21-12-6-8-14-7-2-4-10-17(14)21/h2-5,7,9-11,13H,6,8,12H2,1H3/b16-13+ |
| InChIKey | NLJHPQFXQSMVIR-DTQAZKPQSA-N |
| XLogP | 3.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|