C17H17NO — CID 46930002
8-methyl-8-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one (PubChem CID 46930002) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 8-methyl-8-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one.
| Compound Name | 8-methyl-8-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one |
|---|---|
| PubChem CID | 46930002 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 8-methyl-8-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaen-9-one |
| SMILES | CN1C(=O)CCCc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H17NO/c1-18-16-11-5-4-10-15(16)14-9-3-2-7-13(14)8-6-12-17(18)19/h2-5,7,9-11H,6,8,12H2,1H3 |
| InChIKey | NVFBZKANXSSOAL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |