C13H19NOSi — CID 134893395
1-trimethylsilyl-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 134893395) has the molecular formula C13H19NOSi and a molecular weight of 233.39 g/mol. Its IUPAC name is 1-trimethylsilyl-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1-trimethylsilyl-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 134893395 |
| Molecular Formula | C13H19NOSi |
| Molecular Weight | 233.39 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-trimethylsilyl-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | C[Si](C)(C)N1C(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C13H19NOSi/c1-16(2,3)14-12-9-5-4-7-11(12)8-6-10-13(14)15/h4-5,7,9H,6,8,10H2,1-3H3 |
| InChIKey | FFRZBAOYQMPCSL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|