C17H17NO — CID 56977746
1-(3-methylphenyl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 56977746) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1-(3-methylphenyl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 56977746 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(3-methylphenyl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | Cc1cccc(N2C(=O)CCCc3ccccc32)c1 |
| InChI | InChI=1S/C17H17NO/c1-13-6-4-9-15(12-13)18-16-10-3-2-7-14(16)8-5-11-17(18)19/h2-4,6-7,9-10,12H,5,8,11H2,1H3 |
| InChIKey | RTFJEPKXSYKMPU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |