C11H10FNO2 — CID 82077412
1-(3-fluorophenyl)piperidine-2,6-dione (PubChem CID 82077412) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 1-(3-fluorophenyl)piperidine-2,6-dione.
| Compound Name | 1-(3-fluorophenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 82077412 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-(3-fluorophenyl)piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C11H10FNO2/c12-8-3-1-4-9(7-8)13-10(14)5-2-6-11(13)15/h1,3-4,7H,2,5-6H2 |
| InChIKey | PCKAICUICFXCSW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|