C18H16FNO2 — CID 164678079
1-(3-fluorophenyl)-6,7-dihydro-5H-1-benzazonine-2,4-dione (PubChem CID 164678079) has the molecular formula C18H16FNO2 and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-6,7-dihydro-5H-1-benzazonine-2,4-dione.
| Compound Name | 1-(3-fluorophenyl)-6,7-dihydro-5H-1-benzazonine-2,4-dione |
|---|---|
| PubChem CID | 164678079 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(3-fluorophenyl)-6,7-dihydro-5H-1-benzazonine-2,4-dione |
| SMILES | O=C1CCCc2ccccc2N(c2cccc(F)c2)C(=O)C1 |
| InChI | InChI=1S/C18H16FNO2/c19-14-7-4-8-15(11-14)20-17-10-2-1-5-13(17)6-3-9-16(21)12-18(20)22/h1-2,4-5,7-8,10-11H,3,6,9,12H2 |
| InChIKey | MZWZMEWVXQAOFV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|