C15H11FN2O — CID 152766766
1-(3-fluorophenyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 152766766) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | 1-(3-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 152766766 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-(3-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=Cc2ccccc2N1c1cccc(F)c1 |
| InChI | InChI=1S/C15H11FN2O/c16-12-5-3-6-13(8-12)18-14-7-2-1-4-11(14)9-17-10-15(18)19/h1-9H,10H2 |
| InChIKey | MWXADFHYUDJWIV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |