C11H10N4O2 — CID 113220542
N-(4-cyano-1-methylpyrazol-5-yl)-2-methylfuran-3-carboxamide (PubChem CID 113220542) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-5-yl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(4-cyano-1-methylpyrazol-5-yl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 113220542 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-5-yl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1c(C#N)cnn1C |
| InChI | InChI=1S/C11H10N4O2/c1-7-9(3-4-17-7)11(16)14-10-8(5-12)6-13-15(10)2/h3-4,6H,1-2H3,(H,14,16) |
| InChIKey | XSNLVGFKSRACNA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |