C13H9N5O — CID 112723104
4-cyano-N-(4-cyano-1-methylpyrazol-5-yl)benzamide (PubChem CID 112723104) has the molecular formula C13H9N5O and a molecular weight of 251.25 g/mol. Its IUPAC name is 4-cyano-N-(4-cyano-1-methylpyrazol-5-yl)benzamide.
| Compound Name | 4-cyano-N-(4-cyano-1-methylpyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 112723104 |
| Molecular Formula | C13H9N5O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-cyano-N-(4-cyano-1-methylpyrazol-5-yl)benzamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H9N5O/c1-18-12(11(7-15)8-16-18)17-13(19)10-4-2-9(6-14)3-5-10/h2-5,8H,1H3,(H,17,19) |
| InChIKey | TUYDBNSLGZOAOU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |