C7H5Cl3N4O — CID 108737045
2,2,2-trichloro-N-(4-cyano-1-methylpyrazol-5-yl)acetamide (PubChem CID 108737045) has the molecular formula C7H5Cl3N4O and a molecular weight of 267.50 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(4-cyano-1-methylpyrazol-5-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(4-cyano-1-methylpyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 108737045 |
| Molecular Formula | C7H5Cl3N4O |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 2,2,2-trichloro-N-(4-cyano-1-methylpyrazol-5-yl)acetamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H5Cl3N4O/c1-14-5(4(2-11)3-12-14)13-6(15)7(8,9)10/h3H,1H3,(H,13,15) |
| InChIKey | RRJACTQDOXBHOX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|