C8H9ClN4O2 — CID 108737063
2-chloroethyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate (PubChem CID 108737063) has the molecular formula C8H9ClN4O2 and a molecular weight of 228.64 g/mol. Its IUPAC name is 2-chloroethyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate.
| Compound Name | 2-chloroethyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 108737063 |
| Molecular Formula | C8H9ClN4O2 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-chloroethyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate |
| SMILES | Cn1ncc(C#N)c1NC(=O)OCCCl |
| InChI | InChI=1S/C8H9ClN4O2/c1-13-7(6(4-10)5-11-13)12-8(14)15-3-2-9/h5H,2-3H2,1H3,(H,12,14) |
| InChIKey | PAYPFFUSXUIKJZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|