C12H10N4O2 — CID 79503955
phenyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate (PubChem CID 79503955) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is phenyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate.
| Compound Name | phenyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 79503955 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | phenyl N-(4-cyano-1-methylpyrazol-5-yl)carbamate |
| SMILES | Cn1ncc(C#N)c1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H10N4O2/c1-16-11(9(7-13)8-14-16)15-12(17)18-10-5-3-2-4-6-10/h2-6,8H,1H3,(H,15,17) |
| InChIKey | WNMJUFINSZFOSG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |