C13H10N6O5 — CID 108737053
N-(4-cyano-1-methylpyrazol-5-yl)-4-methyl-3,5-dinitrobenzamide (PubChem CID 108737053) has the molecular formula C13H10N6O5 and a molecular weight of 330.26 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-5-yl)-4-methyl-3,5-dinitrobenzamide.
| Compound Name | N-(4-cyano-1-methylpyrazol-5-yl)-4-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 108737053 |
| Molecular Formula | C13H10N6O5 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-5-yl)-4-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)Nc2c(C#N)cnn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N6O5/c1-7-10(18(21)22)3-8(4-11(7)19(23)24)13(20)16-12-9(5-14)6-15-17(12)2/h3-4,6H,1-2H3,(H,16,20) |
| InChIKey | VMVKVDGLMSPPFU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|