C19H38N4O2 — CID 113223766
tert-butyl 4-[[2-methyl-2-(4-methylpiperazin-1-yl)propyl]amino]piperidine-1-carboxylate (PubChem CID 113223766) has the molecular formula C19H38N4O2 and a molecular weight of 354.54 g/mol. Its IUPAC name is tert-butyl 4-[[2-methyl-2-(4-methylpiperazin-1-yl)propyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-methyl-2-(4-methylpiperazin-1-yl)propyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113223766 |
| Molecular Formula | C19H38N4O2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | tert-butyl 4-[[2-methyl-2-(4-methylpiperazin-1-yl)propyl]amino]piperidine-1-carboxylate |
| SMILES | CN1CCN(C(C)(C)CNC2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H38N4O2/c1-18(2,3)25-17(24)22-9-7-16(8-10-22)20-15-19(4,5)23-13-11-21(6)12-14-23/h16,20H,7-15H2,1-6H3 |
| InChIKey | FDJUMZWEXASWBU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |