C12H20N4O — CID 113224306
2-amino-N-(4,6-dimethylpyrimidin-2-yl)hexanamide (PubChem CID 113224306) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-amino-N-(4,6-dimethylpyrimidin-2-yl)hexanamide.
| Compound Name | 2-amino-N-(4,6-dimethylpyrimidin-2-yl)hexanamide |
|---|---|
| PubChem CID | 113224306 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-amino-N-(4,6-dimethylpyrimidin-2-yl)hexanamide |
| SMILES | CCCCC(N)C(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C12H20N4O/c1-4-5-6-10(13)11(17)16-12-14-8(2)7-9(3)15-12/h7,10H,4-6,13H2,1-3H3,(H,14,15,16,17) |
| InChIKey | GOUAMHOYHGPPAL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |