C11H18N4O — CID 61148022
(2S)-2-amino-N-(4,6-dimethylpyrimidin-2-yl)-3-methylbutanamide (PubChem CID 61148022) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (2S)-2-amino-N-(4,6-dimethylpyrimidin-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-(4,6-dimethylpyrimidin-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 61148022 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2S)-2-amino-N-(4,6-dimethylpyrimidin-2-yl)-3-methylbutanamide |
| SMILES | Cc1cc(C)nc(NC(=O)[C@@H](N)C(C)C)n1 |
| InChI | InChI=1S/C11H18N4O/c1-6(2)9(12)10(16)15-11-13-7(3)5-8(4)14-11/h5-6,9H,12H2,1-4H3,(H,13,14,15,16)/t9-/m0/s1 |
| InChIKey | TVVHQWOGAVYEGL-VIFPVBQESA-N |
| XLogP | 1.02 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |