About 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile
2-morpholin-4-yl-1,3-selenazole-5-carbonitrile (PubChem CID 11322442) has the molecular formula C8H9N3OSe
and a molecular weight of 242.14 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile |
| PubChem CID | 11322442 |
| Molecular Formula | C8H9N3OSe |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile |
| SMILES | N#Cc1cnc(N2CCOCC2)[se]1 |
| InChI | InChI=1S/C8H9N3OSe/c9-5-7-6-10-8(13-7)11-1-3-12-4-2-11/h6H,1-4H2 |
| InChIKey | MZDISZKBLSTVMI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile?
The IUPAC name of 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile (CID 11322442) is 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile.
What is the SMILES notation for 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile?
The canonical SMILES for 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile is N#Cc1cnc(N2CCOCC2)[se]1.
What is the InChIKey of 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile?
The InChIKey is MZDISZKBLSTVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OSe/c9-5-7-6-10-8(13-7)11-1-3-12-4-2-11/h6H,1-4H2.
What are the key properties of 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile?
2-morpholin-4-yl-1,3-selenazole-5-carbonitrile has a molecular weight of 242.14 g/mol, XLogP of -0.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1,3-selenazole-5-carbonitrile is sourced from PubChem (CID 11322442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).