C13H11ClN2S — CID 113225131
6-(3-chlorophenyl)-3,5-dimethylimidazo[2,1-b][1,3]thiazole (PubChem CID 113225131) has the molecular formula C13H11ClN2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-3,5-dimethylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(3-chlorophenyl)-3,5-dimethylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 113225131 |
| Molecular Formula | C13H11ClN2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 6-(3-chlorophenyl)-3,5-dimethylimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1csc2nc(-c3cccc(Cl)c3)c(C)n12 |
| InChI | InChI=1S/C13H11ClN2S/c1-8-7-17-13-15-12(9(2)16(8)13)10-4-3-5-11(14)6-10/h3-7H,1-2H3 |
| InChIKey | TYMRFUIYIXVEJR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |