C17H22BrN3O2S — CID 113226086
2-amino-N-benzyl-4-bromo-N-[2-(dimethylamino)ethyl]benzenesulfonamide (PubChem CID 113226086) has the molecular formula C17H22BrN3O2S and a molecular weight of 412.35 g/mol. Its IUPAC name is 2-amino-N-benzyl-4-bromo-N-[2-(dimethylamino)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-N-benzyl-4-bromo-N-[2-(dimethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113226086 |
| Molecular Formula | C17H22BrN3O2S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-amino-N-benzyl-4-bromo-N-[2-(dimethylamino)ethyl]benzenesulfonamide |
| SMILES | CN(C)CCN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C17H22BrN3O2S/c1-20(2)10-11-21(13-14-6-4-3-5-7-14)24(22,23)17-9-8-15(18)12-16(17)19/h3-9,12H,10-11,13,19H2,1-2H3 |
| InChIKey | QHMGMUSNLIWNOF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|