C16H20BrClN2O3S — CID 120584229
N-(2-aminoethyl)-N-benzyl-5-bromo-2-methoxybenzenesulfonamide;hydrochloride (PubChem CID 120584229) has the molecular formula C16H20BrClN2O3S and a molecular weight of 435.77 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-5-bromo-2-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-N-benzyl-5-bromo-2-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120584229 |
| Molecular Formula | C16H20BrClN2O3S |
| Molecular Weight | 435.77 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-5-bromo-2-methoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)N(CCN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C16H19BrN2O3S.ClH/c1-22-15-8-7-14(17)11-16(15)23(20,21)19(10-9-18)12-13-5-3-2-4-6-13;/h2-8,11H,9-10,12,18H2,1H3;1H |
| InChIKey | RSXVGYDXUYAGOW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |