C25H23NO3S — CID 2899093
N,N-dibenzyl-4-methoxynaphthalene-1-sulfonamide (PubChem CID 2899093) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is N,N-dibenzyl-4-methoxynaphthalene-1-sulfonamide.
| Compound Name | N,N-dibenzyl-4-methoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 2899093 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N,N-dibenzyl-4-methoxynaphthalene-1-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H23NO3S/c1-29-24-16-17-25(23-15-9-8-14-22(23)24)30(27,28)26(18-20-10-4-2-5-11-20)19-21-12-6-3-7-13-21/h2-17H,18-19H2,1H3 |
| InChIKey | PIPKNIBAHWMGEE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |