C15H25BrN2O3S — CID 3751126
5-bromo-N-[2-(diethylamino)ethyl]-N-ethyl-2-methoxybenzenesulfonamide (PubChem CID 3751126) has the molecular formula C15H25BrN2O3S and a molecular weight of 393.35 g/mol. Its IUPAC name is 5-bromo-N-[2-(diethylamino)ethyl]-N-ethyl-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[2-(diethylamino)ethyl]-N-ethyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3751126 |
| Molecular Formula | C15H25BrN2O3S |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 5-bromo-N-[2-(diethylamino)ethyl]-N-ethyl-2-methoxybenzenesulfonamide |
| SMILES | CCN(CC)CCN(CC)S(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H25BrN2O3S/c1-5-17(6-2)10-11-18(7-3)22(19,20)15-12-13(16)8-9-14(15)21-4/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | OJRHPOMUHULNGK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |