C10H13BrFNO2S — CID 110760985
5-bromo-N,N-diethyl-2-fluorobenzenesulfonamide (PubChem CID 110760985) has the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. Its IUPAC name is 5-bromo-N,N-diethyl-2-fluorobenzenesulfonamide.
| Compound Name | 5-bromo-N,N-diethyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 110760985 |
| Molecular Formula | C10H13BrFNO2S |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 5-bromo-N,N-diethyl-2-fluorobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H13BrFNO2S/c1-3-13(4-2)16(14,15)10-7-8(11)5-6-9(10)12/h5-7H,3-4H2,1-2H3 |
| InChIKey | AMNSFQKASZQRAF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |