C19H19F2N3 — CID 113228766
3-benzyl-5-(2,4-difluorophenyl)-2-propan-2-ylimidazol-4-amine (PubChem CID 113228766) has the molecular formula C19H19F2N3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-benzyl-5-(2,4-difluorophenyl)-2-propan-2-ylimidazol-4-amine.
| Compound Name | 3-benzyl-5-(2,4-difluorophenyl)-2-propan-2-ylimidazol-4-amine |
|---|---|
| PubChem CID | 113228766 |
| Molecular Formula | C19H19F2N3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-benzyl-5-(2,4-difluorophenyl)-2-propan-2-ylimidazol-4-amine |
| SMILES | CC(C)c1nc(-c2ccc(F)cc2F)c(N)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H19F2N3/c1-12(2)19-23-17(15-9-8-14(20)10-16(15)21)18(22)24(19)11-13-6-4-3-5-7-13/h3-10,12H,11,22H2,1-2H3 |
| InChIKey | JCFJJGJHFVDIRB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |