C21H17FN2O2 — CID 123812154
3-[(4-fluorophenyl)methyl]-2-propan-2-ylbenzo[e]benzimidazole-4,5-dione (PubChem CID 123812154) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-2-propan-2-ylbenzo[e]benzimidazole-4,5-dione.
| Compound Name | 3-[(4-fluorophenyl)methyl]-2-propan-2-ylbenzo[e]benzimidazole-4,5-dione |
|---|---|
| PubChem CID | 123812154 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-2-propan-2-ylbenzo[e]benzimidazole-4,5-dione |
| SMILES | CC(C)c1nc2c(n1Cc1ccc(F)cc1)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H17FN2O2/c1-12(2)21-23-17-15-5-3-4-6-16(15)19(25)20(26)18(17)24(21)11-13-7-9-14(22)10-8-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | NYMRPHHHLUHDCR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|