C14H23NO2S — CID 113230159
N-[2-(benzenesulfonyl)ethyl]-4-methylpentan-1-amine (PubChem CID 113230159) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-4-methylpentan-1-amine.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 113230159 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-4-methylpentan-1-amine |
| SMILES | CC(C)CCCNCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H23NO2S/c1-13(2)7-6-10-15-11-12-18(16,17)14-8-4-3-5-9-14/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3 |
| InChIKey | AGHBEPJWAZQILG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|