C17H29N3O3S — CID 87038970
3-[2-(benzenesulfonyl)ethyl]-1-[2-(dimethylamino)ethyl]-1-(2-methylpropyl)urea (PubChem CID 87038970) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)ethyl]-1-[2-(dimethylamino)ethyl]-1-(2-methylpropyl)urea.
| Compound Name | 3-[2-(benzenesulfonyl)ethyl]-1-[2-(dimethylamino)ethyl]-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 87038970 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[2-(benzenesulfonyl)ethyl]-1-[2-(dimethylamino)ethyl]-1-(2-methylpropyl)urea |
| SMILES | CC(C)CN(CCN(C)C)C(=O)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H29N3O3S/c1-15(2)14-20(12-11-19(3)4)17(21)18-10-13-24(22,23)16-8-6-5-7-9-16/h5-9,15H,10-14H2,1-4H3,(H,18,21) |
| InChIKey | NGMLFGVPAKVDPU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |