C24H36N4O3S — CID 14855277
1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-[2-(N-methylanilino)ethyl]urea (PubChem CID 14855277) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-[2-(N-methylanilino)ethyl]urea.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-[2-(N-methylanilino)ethyl]urea |
|---|---|
| PubChem CID | 14855277 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-[2-(diethylamino)ethyl]-1-[2-(N-methylanilino)ethyl]urea |
| SMILES | CCN(CC)CCNC(=O)N(CCN(C)c1ccccc1)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H36N4O3S/c1-4-27(5-2)17-16-25-24(29)28(19-18-26(3)22-12-8-6-9-13-22)20-21-32(30,31)23-14-10-7-11-15-23/h6-15H,4-5,16-21H2,1-3H3,(H,25,29) |
| InChIKey | CXLWHOFRQYVXCB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |