C21H38N4O2 — CID 14855287
1,3-bis[2-(diethylamino)ethyl]-1-(2-phenoxyethyl)urea (PubChem CID 14855287) has the molecular formula C21H38N4O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 1,3-bis[2-(diethylamino)ethyl]-1-(2-phenoxyethyl)urea.
| Compound Name | 1,3-bis[2-(diethylamino)ethyl]-1-(2-phenoxyethyl)urea |
|---|---|
| PubChem CID | 14855287 |
| Molecular Formula | C21H38N4O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 1,3-bis[2-(diethylamino)ethyl]-1-(2-phenoxyethyl)urea |
| SMILES | CCN(CC)CCNC(=O)N(CCOc1ccccc1)CCN(CC)CC |
| InChI | InChI=1S/C21H38N4O2/c1-5-23(6-2)15-14-22-21(26)25(17-16-24(7-3)8-4)18-19-27-20-12-10-9-11-13-20/h9-13H,5-8,14-19H2,1-4H3,(H,22,26) |
| InChIKey | HACKFRXRVXHBJJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |