C21H38N4O3S — CID 14855265
1-[2-(benzenesulfonyl)ethyl]-1,3-bis[2-(diethylamino)ethyl]urea (PubChem CID 14855265) has the molecular formula C21H38N4O3S and a molecular weight of 426.63 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-1,3-bis[2-(diethylamino)ethyl]urea.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-1,3-bis[2-(diethylamino)ethyl]urea |
|---|---|
| PubChem CID | 14855265 |
| Molecular Formula | C21H38N4O3S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-1,3-bis[2-(diethylamino)ethyl]urea |
| SMILES | CCN(CC)CCNC(=O)N(CCN(CC)CC)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H38N4O3S/c1-5-23(6-2)15-14-22-21(26)25(17-16-24(7-3)8-4)18-19-29(27,28)20-12-10-9-11-13-20/h9-13H,5-8,14-19H2,1-4H3,(H,22,26) |
| InChIKey | JIDNFGINWSWIID-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |