C18H32N3O3S+ — CID 86308700
2-[[2-(benzenesulfonyl)ethyl-propan-2-ylcarbamoyl]amino]ethyl-diethylazanium (PubChem CID 86308700) has the molecular formula C18H32N3O3S+ and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-[[2-(benzenesulfonyl)ethyl-propan-2-ylcarbamoyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[[2-(benzenesulfonyl)ethyl-propan-2-ylcarbamoyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 86308700 |
| Molecular Formula | C18H32N3O3S+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-[[2-(benzenesulfonyl)ethyl-propan-2-ylcarbamoyl]amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNC(=O)N(CCS(=O)(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C18H31N3O3S/c1-5-20(6-2)13-12-19-18(22)21(16(3)4)14-15-25(23,24)17-10-8-7-9-11-17/h7-11,16H,5-6,12-15H2,1-4H3,(H,19,22)/p+1 |
| InChIKey | OSTGVQSWUXGHKL-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |