C14H30N2O3 — CID 88699422
2-methylpropanoic acid;1-propan-2-yl-1,3-dipropylurea (PubChem CID 88699422) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-methylpropanoic acid;1-propan-2-yl-1,3-dipropylurea.
| Compound Name | 2-methylpropanoic acid;1-propan-2-yl-1,3-dipropylurea |
|---|---|
| PubChem CID | 88699422 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2-methylpropanoic acid;1-propan-2-yl-1,3-dipropylurea |
| SMILES | CC(C)C(=O)O.CCCNC(=O)N(CCC)C(C)C |
| InChI | InChI=1S/C10H22N2O.C4H8O2/c1-5-7-11-10(13)12(8-6-2)9(3)4;1-3(2)4(5)6/h9H,5-8H2,1-4H3,(H,11,13);3H,1-2H3,(H,5,6) |
| InChIKey | YCAYUGVVRSBVMV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |