C14H28N2O3 — CID 80541783
2-methyl-4-[[pentyl(propan-2-yl)carbamoyl]amino]butanoic acid (PubChem CID 80541783) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-methyl-4-[[pentyl(propan-2-yl)carbamoyl]amino]butanoic acid.
| Compound Name | 2-methyl-4-[[pentyl(propan-2-yl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 80541783 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-methyl-4-[[pentyl(propan-2-yl)carbamoyl]amino]butanoic acid |
| SMILES | CCCCCN(C(=O)NCCC(C)C(=O)O)C(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-5-6-7-10-16(11(2)3)14(19)15-9-8-12(4)13(17)18/h11-12H,5-10H2,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | PMFYNQRLUWAENP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|