C10H20N2O — CID 115585837
1-propan-2-yl-1-prop-2-enyl-3-propylurea (PubChem CID 115585837) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-propan-2-yl-1-prop-2-enyl-3-propylurea.
| Compound Name | 1-propan-2-yl-1-prop-2-enyl-3-propylurea |
|---|---|
| PubChem CID | 115585837 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-propan-2-yl-1-prop-2-enyl-3-propylurea |
| SMILES | C=CCN(C(=O)NCCC)C(C)C |
| InChI | InChI=1S/C10H20N2O/c1-5-7-11-10(13)12(8-6-2)9(3)4/h6,9H,2,5,7-8H2,1,3-4H3,(H,11,13) |
| InChIKey | JOKSPVQUHZODRA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|