C8H16N2O — CID 115588417
3-methyl-1-propan-2-yl-1-prop-2-enylurea (PubChem CID 115588417) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-methyl-1-propan-2-yl-1-prop-2-enylurea.
| Compound Name | 3-methyl-1-propan-2-yl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 115588417 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3-methyl-1-propan-2-yl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NC)C(C)C |
| InChI | InChI=1S/C8H16N2O/c1-5-6-10(7(2)3)8(11)9-4/h5,7H,1,6H2,2-4H3,(H,9,11) |
| InChIKey | QAFHHKIVNZHXME-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|