C12H22N2O — CID 60946878
2-(cyclopropylmethylamino)-N-propan-2-yl-N-prop-2-enylacetamide (PubChem CID 60946878) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-propan-2-yl-N-prop-2-enylacetamide.
| Compound Name | 2-(cyclopropylmethylamino)-N-propan-2-yl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 60946878 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-propan-2-yl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CNCC1CC1)C(C)C |
| InChI | InChI=1S/C12H22N2O/c1-4-7-14(10(2)3)12(15)9-13-8-11-5-6-11/h4,10-11,13H,1,5-9H2,2-3H3 |
| InChIKey | SMYGOUUYEYKBIT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|