C12H12F2N2O — CID 113231690
2-(4-cyanophenyl)-N-(2,2-difluoroethyl)-N-methylacetamide (PubChem CID 113231690) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-N-(2,2-difluoroethyl)-N-methylacetamide.
| Compound Name | 2-(4-cyanophenyl)-N-(2,2-difluoroethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 113231690 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(4-cyanophenyl)-N-(2,2-difluoroethyl)-N-methylacetamide |
| SMILES | CN(CC(F)F)C(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H12F2N2O/c1-16(8-11(13)14)12(17)6-9-2-4-10(7-15)5-3-9/h2-5,11H,6,8H2,1H3 |
| InChIKey | HXLYIFUTBBSWTR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |