C11H8F3NO — CID 175527432
4-(2,4,4-trifluoro-3-oxobutyl)benzonitrile (PubChem CID 175527432) has the molecular formula C11H8F3NO and a molecular weight of 227.19 g/mol. Its IUPAC name is 4-(2,4,4-trifluoro-3-oxobutyl)benzonitrile.
| Compound Name | 4-(2,4,4-trifluoro-3-oxobutyl)benzonitrile |
|---|---|
| PubChem CID | 175527432 |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-(2,4,4-trifluoro-3-oxobutyl)benzonitrile |
| SMILES | N#Cc1ccc(CC(F)C(=O)C(F)F)cc1 |
| InChI | InChI=1S/C11H8F3NO/c12-9(10(16)11(13)14)5-7-1-3-8(6-15)4-2-7/h1-4,9,11H,5H2 |
| InChIKey | ZEDMSFLYVVWGNT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |