C18H24N4O3S — CID 113232815
2-[[3-[benzyl(methyl)amino]propylcarbamoylamino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 113232815) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[[3-[benzyl(methyl)amino]propylcarbamoylamino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[3-[benzyl(methyl)amino]propylcarbamoylamino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 113232815 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[[3-[benzyl(methyl)amino]propylcarbamoylamino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(CNC(=O)NCCCN(C)Cc2ccccc2)sc1C(=O)O |
| InChI | InChI=1S/C18H24N4O3S/c1-13-16(17(23)24)26-15(21-13)11-20-18(25)19-9-6-10-22(2)12-14-7-4-3-5-8-14/h3-5,7-8H,6,9-12H2,1-2H3,(H,23,24)(H2,19,20,25) |
| InChIKey | FNJSEIWYVRWEOM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|