C9H17N3O4S — CID 113233795
N-[2-(ethylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 113233795) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113233795 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C9H17N3O4S/c1-2-12-17(15,16)4-3-10-9(14)7-5-8(13)11-6-7/h7,12H,2-6H2,1H3,(H,10,14)(H,11,13) |
| InChIKey | ASOZFLDOLUEIBY-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |