C13H7N3OS — CID 113233875
3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)benzonitrile (PubChem CID 113233875) has the molecular formula C13H7N3OS and a molecular weight of 253.29 g/mol. Its IUPAC name is 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)benzonitrile.
| Compound Name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 113233875 |
| Molecular Formula | C13H7N3OS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(-c3ccsc3)no2)c1 |
| InChI | InChI=1S/C13H7N3OS/c14-7-9-2-1-3-10(6-9)13-15-12(16-17-13)11-4-5-18-8-11/h1-6,8H |
| InChIKey | LEBBOFFJNWVSHS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |