C18H12N4O — CID 123450923
3-[3-(1-imino-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile (PubChem CID 123450923) has the molecular formula C18H12N4O and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-[3-(1-imino-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile.
| Compound Name | 3-[3-(1-imino-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 123450923 |
| Molecular Formula | C18H12N4O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3-[3-(1-imino-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile |
| SMILES | [H]/N=C1\CCc2c1cccc2-c1noc(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C18H12N4O/c19-10-11-3-1-4-12(9-11)18-21-17(22-23-18)15-6-2-5-14-13(15)7-8-16(14)20/h1-6,9,20H,7-8H2/b20-16+ |
| InChIKey | RWCXXMIDTCONNG-CAPFRKAQSA-N |
| XLogP | 3.59 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|